C14H19FN2O3 — CID 123711266
tert-butyl N-[2-fluoro-2-[4-(nitrosomethyl)phenyl]ethyl]carbamate (PubChem CID 123711266) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-2-[4-(nitrosomethyl)phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-2-[4-(nitrosomethyl)phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 123711266 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | tert-butyl N-[2-fluoro-2-[4-(nitrosomethyl)phenyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(F)c1ccc(CN=O)cc1 |
| InChI | InChI=1S/C14H19FN2O3/c1-14(2,3)20-13(18)16-9-12(15)11-6-4-10(5-7-11)8-17-19/h4-7,12H,8-9H2,1-3H3,(H,16,18) |
| InChIKey | SHXIBYCGQOVBSH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |