C14H17N7O3 — CID 123711482
3,4,4-triamino-3-(5-amino-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione (PubChem CID 123711482) has the molecular formula C14H17N7O3 and a molecular weight of 331.34 g/mol. Its IUPAC name is 3,4,4-triamino-3-(5-amino-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | 3,4,4-triamino-3-(5-amino-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 123711482 |
| Molecular Formula | C14H17N7O3 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 3,4,4-triamino-3-(5-amino-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1nc2cccc(N)c2c(=O)n1C1(N)C(=O)NC(=O)CC1(N)N |
| InChI | InChI=1S/C14H17N7O3/c1-6-19-8-4-2-3-7(15)10(8)11(23)21(6)14(18)12(24)20-9(22)5-13(14,16)17/h2-4H,5,15-18H2,1H3,(H,20,22,24) |
| InChIKey | AVVRBVJXUGZEAA-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 185.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|