C13H9BN4O3 — CID 144586058
7-amino-2,10,13-triaza-17-borapentacyclo[8.7.0.03,8.011,16.011,17]heptadeca-1,3,5,7-tetraene-9,12,14-trione (PubChem CID 144586058) has the molecular formula C13H9BN4O3 and a molecular weight of 280.05 g/mol. Its IUPAC name is 7-amino-2,10,13-triaza-17-borapentacyclo[8.7.0.03,8.011,16.011,17]heptadeca-1,3,5,7-tetraene-9,12,14-trione.
| Compound Name | 7-amino-2,10,13-triaza-17-borapentacyclo[8.7.0.03,8.011,16.011,17]heptadeca-1,3,5,7-tetraene-9,12,14-trione |
|---|---|
| PubChem CID | 144586058 |
| Molecular Formula | C13H9BN4O3 |
| Molecular Weight | 280.05 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 7-amino-2,10,13-triaza-17-borapentacyclo[8.7.0.03,8.011,16.011,17]heptadeca-1,3,5,7-tetraene-9,12,14-trione |
| SMILES | Nc1cccc2nc3n(c(=O)c12)C12B3C1CC(=O)NC2=O |
| InChI | InChI=1S/C13H9BN4O3/c15-5-2-1-3-6-9(5)10(20)18-12(16-6)14-7-4-8(19)17-11(21)13(7,14)18/h1-3,7H,4,15H2,(H,17,19,21) |
| InChIKey | IHQGQLAIZBBKDJ-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.05 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|