C15H16N4O3 — CID 156677475
(3R)-3-[5-amino-4-oxo-2-(trideuteriomethyl)quinazolin-3-yl]-4,4,5,5-tetradeuterio-3-(trideuteriomethyl)piperidine-2,6-dione (PubChem CID 156677475) has the molecular formula C15H16N4O3 and a molecular weight of 310.38 g/mol. Its IUPAC name is (3R)-3-[5-amino-4-oxo-2-(trideuteriomethyl)quinazolin-3-yl]-4,4,5,5-tetradeuterio-3-(trideuteriomethyl)piperidine-2,6-dione.
| Compound Name | (3R)-3-[5-amino-4-oxo-2-(trideuteriomethyl)quinazolin-3-yl]-4,4,5,5-tetradeuterio-3-(trideuteriomethyl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 156677475 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | (3R)-3-[5-amino-4-oxo-2-(trideuteriomethyl)quinazolin-3-yl]-4,4,5,5-tetradeuterio-3-(trideuteriomethyl)piperidine-2,6-dione |
| SMILES | [2H]C([2H])([2H])c1nc2cccc(N)c2c(=O)n1[C@@]1(C([2H])([2H])[2H])C(=O)NC(=O)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C15H16N4O3/c1-8-17-10-5-3-4-9(16)12(10)13(21)19(8)15(2)7-6-11(20)18-14(15)22/h3-5H,6-7,16H2,1-2H3,(H,18,20,22)/t15-/m1/s1/i1D3,2D3,6D2,7D2 |
| InChIKey | YBEDEOMQBHQZHU-HJHGKPNNSA-N |
| XLogP | 0.44 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|