C14H18N8O3 — CID 123273426
3,4-diamino-3-(5,7,8-triamino-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione (PubChem CID 123273426) has the molecular formula C14H18N8O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is 3,4-diamino-3-(5,7,8-triamino-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | 3,4-diamino-3-(5,7,8-triamino-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 123273426 |
| Molecular Formula | C14H18N8O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3,4-diamino-3-(5,7,8-triamino-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1nc2c(N)c(N)cc(N)c2c(=O)n1C1(N)C(=O)NC(=O)CC1N |
| InChI | InChI=1S/C14H18N8O3/c1-4-20-11-9(5(15)2-6(16)10(11)18)12(24)22(4)14(19)7(17)3-8(23)21-13(14)25/h2,7H,3,15-19H2,1H3,(H,21,23,25) |
| InChIKey | FCADPMIFROHKRM-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 211.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|