C19H17N3O3 — CID 159755241
(3S)-3-methyl-3-(2-methyl-4-oxobenzo[g]quinazolin-3-yl)piperidine-2,6-dione (PubChem CID 159755241) has the molecular formula C19H17N3O3 and a molecular weight of 335.36 g/mol. Its IUPAC name is (3S)-3-methyl-3-(2-methyl-4-oxobenzo[g]quinazolin-3-yl)piperidine-2,6-dione.
| Compound Name | (3S)-3-methyl-3-(2-methyl-4-oxobenzo[g]quinazolin-3-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 159755241 |
| Molecular Formula | C19H17N3O3 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (3S)-3-methyl-3-(2-methyl-4-oxobenzo[g]quinazolin-3-yl)piperidine-2,6-dione |
| SMILES | Cc1nc2cc3ccccc3cc2c(=O)n1[C@@]1(C)CCC(=O)NC1=O |
| InChI | InChI=1S/C19H17N3O3/c1-11-20-15-10-13-6-4-3-5-12(13)9-14(15)17(24)22(11)19(2)8-7-16(23)21-18(19)25/h3-6,9-10H,7-8H2,1-2H3,(H,21,23,25)/t19-/m0/s1 |
| InChIKey | BWLIIVJEEWCTDT-IBGZPJMESA-N |
| XLogP | 2.01 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|