C15H16N4O3 — CID 147342088
(3S)-3-(7-amino-2-methyl-4-oxoquinazolin-3-yl)-3-methylpiperidine-2,6-dione (PubChem CID 147342088) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is (3S)-3-(7-amino-2-methyl-4-oxoquinazolin-3-yl)-3-methylpiperidine-2,6-dione.
| Compound Name | (3S)-3-(7-amino-2-methyl-4-oxoquinazolin-3-yl)-3-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 147342088 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (3S)-3-(7-amino-2-methyl-4-oxoquinazolin-3-yl)-3-methylpiperidine-2,6-dione |
| SMILES | Cc1nc2cc(N)ccc2c(=O)n1[C@@]1(C)CCC(=O)NC1=O |
| InChI | InChI=1S/C15H16N4O3/c1-8-17-11-7-9(16)3-4-10(11)13(21)19(8)15(2)6-5-12(20)18-14(15)22/h3-4,7H,5-6,16H2,1-2H3,(H,18,20,22)/t15-/m0/s1 |
| InChIKey | DDRWXQPEMDTVMI-HNNXBMFYSA-N |
| XLogP | 0.44 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|