C25H27N5O4 — CID 163926206
1-[[2-methyl-3-(3-methyl-2,7-dioxoazepan-3-yl)-4-oxoquinazolin-6-yl]methyl]-3-(3-methylphenyl)urea (PubChem CID 163926206) has the molecular formula C25H27N5O4 and a molecular weight of 461.52 g/mol. Its IUPAC name is 1-[[2-methyl-3-(3-methyl-2,7-dioxoazepan-3-yl)-4-oxoquinazolin-6-yl]methyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[[2-methyl-3-(3-methyl-2,7-dioxoazepan-3-yl)-4-oxoquinazolin-6-yl]methyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 163926206 |
| Molecular Formula | C25H27N5O4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 1-[[2-methyl-3-(3-methyl-2,7-dioxoazepan-3-yl)-4-oxoquinazolin-6-yl]methyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NCc2ccc3nc(C)n(C4(C)CCCC(=O)NC4=O)c(=O)c3c2)c1 |
| InChI | InChI=1S/C25H27N5O4/c1-15-6-4-7-18(12-15)28-24(34)26-14-17-9-10-20-19(13-17)22(32)30(16(2)27-20)25(3)11-5-8-21(31)29-23(25)33/h4,6-7,9-10,12-13H,5,8,11,14H2,1-3H3,(H2,26,28,34)(H,29,31,33) |
| InChIKey | RERQXLXSGWVCNL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|