C8H15NO — CID 123717051
2,4-dimethyl-1-methyliminopentan-3-one (PubChem CID 123717051) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 2,4-dimethyl-1-methyliminopentan-3-one.
| Compound Name | 2,4-dimethyl-1-methyliminopentan-3-one |
|---|---|
| PubChem CID | 123717051 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 2,4-dimethyl-1-methyliminopentan-3-one |
| SMILES | C/N=C/C(C)C(=O)C(C)C |
| InChI | InChI=1S/C8H15NO/c1-6(2)8(10)7(3)5-9-4/h5-7H,1-4H3/b9-5+ |
| InChIKey | XRGANXIJPNWXKV-WEVVVXLNSA-N |
| XLogP | 1.55 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|