C23H17F2NO3S — CID 123717539
1-[1-(benzenesulfonyl)-2-(2,6-difluorophenyl)indol-5-yl]propan-2-one (PubChem CID 123717539) has the molecular formula C23H17F2NO3S and a molecular weight of 425.46 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)-2-(2,6-difluorophenyl)indol-5-yl]propan-2-one.
| Compound Name | 1-[1-(benzenesulfonyl)-2-(2,6-difluorophenyl)indol-5-yl]propan-2-one |
|---|---|
| PubChem CID | 123717539 |
| Molecular Formula | C23H17F2NO3S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 1-[1-(benzenesulfonyl)-2-(2,6-difluorophenyl)indol-5-yl]propan-2-one |
| SMILES | CC(=O)Cc1ccc2c(c1)cc(-c1c(F)cccc1F)n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H17F2NO3S/c1-15(27)12-16-10-11-21-17(13-16)14-22(23-19(24)8-5-9-20(23)25)26(21)30(28,29)18-6-3-2-4-7-18/h2-11,13-14H,12H2,1H3 |
| InChIKey | KRTOCRNJPQXVGH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |