About N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide
N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide (PubChem CID 123718616) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide |
| PubChem CID | 123718616 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC=C(C)N(C)C(=O)C1CC1C |
| InChI | InChI=1S/C10H17NO/c1-5-8(3)11(4)10(12)9-6-7(9)2/h5,7,9H,6H2,1-4H3 |
| InChIKey | WMQYGGZOZBMWFJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide?
The IUPAC name of N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide (CID 123718616) is N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide.
What is the SMILES notation for N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide?
The canonical SMILES for N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide is CC=C(C)N(C)C(=O)C1CC1C.
What is the InChIKey of N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide?
The InChIKey is WMQYGGZOZBMWFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-5-8(3)11(4)10(12)9-6-7(9)2/h5,7,9H,6H2,1-4H3.
What are the key properties of N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide?
N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide has a molecular weight of 167.25 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-2-en-2-yl-N,2-dimethylcyclopropane-1-carboxamide is sourced from PubChem (CID 123718616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).