C10H19NO — CID 123906611
N-but-2-en-2-yl-N,3-dimethylbutanamide (PubChem CID 123906611) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is N-but-2-en-2-yl-N,3-dimethylbutanamide.
| Compound Name | N-but-2-en-2-yl-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 123906611 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | N-but-2-en-2-yl-N,3-dimethylbutanamide |
| SMILES | CC=C(C)N(C)C(=O)CC(C)C |
| InChI | InChI=1S/C10H19NO/c1-6-9(4)11(5)10(12)7-8(2)3/h6,8H,7H2,1-5H3 |
| InChIKey | HFZSLNWPSXERHO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |