C13H21NO — CID 123593342
N-hexa-1,3,5-trien-3-yl-N,3,3-trimethylbutanamide (PubChem CID 123593342) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is N-hexa-1,3,5-trien-3-yl-N,3,3-trimethylbutanamide.
| Compound Name | N-hexa-1,3,5-trien-3-yl-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 123593342 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | N-hexa-1,3,5-trien-3-yl-N,3,3-trimethylbutanamide |
| SMILES | C=CC=C(C=C)N(C)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C13H21NO/c1-7-9-11(8-2)14(6)12(15)10-13(3,4)5/h7-9H,1-2,10H2,3-6H3 |
| InChIKey | WSROCHPBSXDEMN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|