C11H19NO — CID 123333115
N-ethyl-N-penta-2,4-dien-2-ylbutanamide (PubChem CID 123333115) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N-ethyl-N-penta-2,4-dien-2-ylbutanamide.
| Compound Name | N-ethyl-N-penta-2,4-dien-2-ylbutanamide |
|---|---|
| PubChem CID | 123333115 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-ethyl-N-penta-2,4-dien-2-ylbutanamide |
| SMILES | C=CC=C(C)N(CC)C(=O)CCC |
| InChI | InChI=1S/C11H19NO/c1-5-8-10(4)12(7-3)11(13)9-6-2/h5,8H,1,6-7,9H2,2-4H3 |
| InChIKey | PLYPGOLPOJFGMZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|