C12H23NO — CID 123549027
N-but-2-en-2-yl-N-ethyl-3,3-dimethylbutanamide (PubChem CID 123549027) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is N-but-2-en-2-yl-N-ethyl-3,3-dimethylbutanamide.
| Compound Name | N-but-2-en-2-yl-N-ethyl-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 123549027 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-but-2-en-2-yl-N-ethyl-3,3-dimethylbutanamide |
| SMILES | CC=C(C)N(CC)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C12H23NO/c1-7-10(3)13(8-2)11(14)9-12(4,5)6/h7H,8-9H2,1-6H3 |
| InChIKey | GSDKJFFIANPCCI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |