C12H21NO — CID 123343650
N,3,3-trimethyl-N-penta-1,3-dien-3-ylbutanamide (PubChem CID 123343650) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is N,3,3-trimethyl-N-penta-1,3-dien-3-ylbutanamide.
| Compound Name | N,3,3-trimethyl-N-penta-1,3-dien-3-ylbutanamide |
|---|---|
| PubChem CID | 123343650 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | N,3,3-trimethyl-N-penta-1,3-dien-3-ylbutanamide |
| SMILES | C=CC(=CC)N(C)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C12H21NO/c1-7-10(8-2)13(6)11(14)9-12(3,4)5/h7-8H,1,9H2,2-6H3 |
| InChIKey | JWLDZPZYIUXFKS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|