C14H23NO — CID 123751413
N-ethyl-N-hexa-1,3,5-trien-3-yl-3,3-dimethylbutanamide (PubChem CID 123751413) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N-ethyl-N-hexa-1,3,5-trien-3-yl-3,3-dimethylbutanamide.
| Compound Name | N-ethyl-N-hexa-1,3,5-trien-3-yl-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 123751413 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-ethyl-N-hexa-1,3,5-trien-3-yl-3,3-dimethylbutanamide |
| SMILES | C=CC=C(C=C)N(CC)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C14H23NO/c1-7-10-12(8-2)15(9-3)13(16)11-14(4,5)6/h7-8,10H,1-2,9,11H2,3-6H3 |
| InChIKey | CVWTYLAOVXGJNH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|