C14H23NO — CID 123964635
N-hepta-1,3,5-trien-3-yl-N,3,3-trimethylbutanamide (PubChem CID 123964635) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is N-hepta-1,3,5-trien-3-yl-N,3,3-trimethylbutanamide.
| Compound Name | N-hepta-1,3,5-trien-3-yl-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 123964635 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | N-hepta-1,3,5-trien-3-yl-N,3,3-trimethylbutanamide |
| SMILES | C=CC(=CC=CC)N(C)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C14H23NO/c1-7-9-10-12(8-2)15(6)13(16)11-14(3,4)5/h7-10H,2,11H2,1,3-6H3 |
| InChIKey | OFNDZTPCSVEHGU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|