C12H19NO — CID 123536010
N-hexa-1,3,5-trien-3-yl-2,2-dimethylbutanamide (PubChem CID 123536010) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-hexa-1,3,5-trien-3-yl-2,2-dimethylbutanamide.
| Compound Name | N-hexa-1,3,5-trien-3-yl-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 123536010 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-hexa-1,3,5-trien-3-yl-2,2-dimethylbutanamide |
| SMILES | C=CC=C(C=C)NC(=O)C(C)(C)CC |
| InChI | InChI=1S/C12H19NO/c1-6-9-10(7-2)13-11(14)12(4,5)8-3/h6-7,9H,1-2,8H2,3-5H3,(H,13,14) |
| InChIKey | VOMKYKCVISIEMA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|