C9H15NO — CID 90879471
N-penta-1,3-dien-2-ylbutanamide (PubChem CID 90879471) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is N-penta-1,3-dien-2-ylbutanamide.
| Compound Name | N-penta-1,3-dien-2-ylbutanamide |
|---|---|
| PubChem CID | 90879471 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-penta-1,3-dien-2-ylbutanamide |
| SMILES | C=C(C=CC)NC(=O)CCC |
| InChI | InChI=1S/C9H15NO/c1-4-6-8(3)10-9(11)7-5-2/h4,6H,3,5,7H2,1-2H3,(H,10,11) |
| InChIKey | COOOXZFQEIAKOB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|