About lithium N-phenylacetamide
lithium N-phenylacetamide (PubChem CID 139213726) has the molecular formula C8H8LiNO
and a molecular weight of 141.10 g/mol. Its IUPAC name is lithium N-phenylacetamide.
Molecular Properties
| Compound Name | lithium N-phenylacetamide |
| PubChem CID | 139213726 |
| Molecular Formula | C8H8LiNO |
| Molecular Weight | 141.10 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | lithium N-phenylacetamide |
| SMILES | CC(=O)Nc1[c-]cccc1.[Li+] |
| InChI | InChI=1S/C8H8NO.Li/c1-7(10)9-8-5-3-2-4-6-8;/h2-5H,1H3,(H,9,10);/q-1;+1 |
| InChIKey | DDVZPOSKPINCMT-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.10 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium N-phenylacetamide?
The IUPAC name of lithium N-phenylacetamide (CID 139213726) is lithium N-phenylacetamide.
What is the SMILES notation for lithium N-phenylacetamide?
The canonical SMILES for lithium N-phenylacetamide is CC(=O)Nc1[c-]cccc1.[Li+].
What is the InChIKey of lithium N-phenylacetamide?
The InChIKey is DDVZPOSKPINCMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8NO.Li/c1-7(10)9-8-5-3-2-4-6-8;/h2-5H,1H3,(H,9,10);/q-1;+1.
What are the key properties of lithium N-phenylacetamide?
lithium N-phenylacetamide has a molecular weight of 141.10 g/mol, XLogP of -1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium N-phenylacetamide is sourced from PubChem (CID 139213726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).