C9H14F3NO — CID 145030734
ethane;2,2,2-trifluoro-N-[(3E)-penta-1,3-dien-3-yl]acetamide (PubChem CID 145030734) has the molecular formula C9H14F3NO and a molecular weight of 209.21 g/mol. Its IUPAC name is ethane;2,2,2-trifluoro-N-[(3E)-penta-1,3-dien-3-yl]acetamide.
| Compound Name | ethane;2,2,2-trifluoro-N-[(3E)-penta-1,3-dien-3-yl]acetamide |
|---|---|
| PubChem CID | 145030734 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | ethane;2,2,2-trifluoro-N-[(3E)-penta-1,3-dien-3-yl]acetamide |
| SMILES | C=C/C(=C\C)NC(=O)C(F)(F)F.CC |
| InChI | InChI=1S/C7H8F3NO.C2H6/c1-3-5(4-2)11-6(12)7(8,9)10;1-2/h3-4H,1H2,2H3,(H,11,12);1-2H3/b5-4+; |
| InChIKey | CMUQHQSBDHXIJN-FXRZFVDSSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|