About palladium;N-phenylacetamide
palladium;N-phenylacetamide (PubChem CID 134952113) has the molecular formula C8H8NOPd-
and a molecular weight of 240.58 g/mol. Its IUPAC name is palladium;N-phenylacetamide.
Molecular Properties
| Compound Name | palladium;N-phenylacetamide |
| PubChem CID | 134952113 |
| Molecular Formula | C8H8NOPd- |
| Molecular Weight | 240.58 g/mol |
| Exact Mass | 239.96 |
| IUPAC Name | palladium;N-phenylacetamide |
| SMILES | CC(=O)Nc1[c-]cccc1.[Pd] |
| InChI | InChI=1S/C8H8NO.Pd/c1-7(10)9-8-5-3-2-4-6-8;/h2-5H,1H3,(H,9,10);/q-1; |
| InChIKey | YSMBDJNSENPUTG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.58 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze palladium;N-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of palladium;N-phenylacetamide?
The IUPAC name of palladium;N-phenylacetamide (CID 134952113) is palladium;N-phenylacetamide.
What is the SMILES notation for palladium;N-phenylacetamide?
The canonical SMILES for palladium;N-phenylacetamide is CC(=O)Nc1[c-]cccc1.[Pd].
What is the InChIKey of palladium;N-phenylacetamide?
The InChIKey is YSMBDJNSENPUTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8NO.Pd/c1-7(10)9-8-5-3-2-4-6-8;/h2-5H,1H3,(H,9,10);/q-1;.
What are the key properties of palladium;N-phenylacetamide?
palladium;N-phenylacetamide has a molecular weight of 240.58 g/mol, XLogP of 1.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for palladium;N-phenylacetamide is sourced from PubChem (CID 134952113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).