C11H17NO — CID 123264155
N-hexa-1,3,5-trien-3-yl-N,2-dimethylpropanamide (PubChem CID 123264155) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N-hexa-1,3,5-trien-3-yl-N,2-dimethylpropanamide.
| Compound Name | N-hexa-1,3,5-trien-3-yl-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 123264155 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N-hexa-1,3,5-trien-3-yl-N,2-dimethylpropanamide |
| SMILES | C=CC=C(C=C)N(C)C(=O)C(C)C |
| InChI | InChI=1S/C11H17NO/c1-6-8-10(7-2)12(5)11(13)9(3)4/h6-9H,1-2H2,3-5H3 |
| InChIKey | VTBPQUFROJUKKB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|