About N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium
N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium (PubChem CID 59988029) has the molecular formula C11H13FNOY-
and a molecular weight of 283.13 g/mol. Its IUPAC name is N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium.
Molecular Properties
| Compound Name | N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium |
| PubChem CID | 59988029 |
| Molecular Formula | C11H13FNOY- |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium |
| SMILES | CC(C)C(=O)N(C)c1[c-]cccc1F.[Y] |
| InChI | InChI=1S/C11H13FNO.Y/c1-8(2)11(14)13(3)10-7-5-4-6-9(10)12;/h4-6,8H,1-3H3;/q-1; |
| InChIKey | BJMSZFGCNNAZDJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium?
The IUPAC name of N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium (CID 59988029) is N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium.
What is the SMILES notation for N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium?
The canonical SMILES for N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium is CC(C)C(=O)N(C)c1[c-]cccc1F.[Y].
What is the InChIKey of N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium?
The InChIKey is BJMSZFGCNNAZDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FNO.Y/c1-8(2)11(14)13(3)10-7-5-4-6-9(10)12;/h4-6,8H,1-3H3;/q-1;.
What are the key properties of N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium?
N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium has a molecular weight of 283.13 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorobenzene-6-id-1-yl)-N,2-dimethylpropanamide;yttrium is sourced from PubChem (CID 59988029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).