C11H15NO — CID 59893694
1-hepta-1,3,5-trien-4-ylpyrrolidin-2-one (PubChem CID 59893694) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-hepta-1,3,5-trien-4-ylpyrrolidin-2-one.
| Compound Name | 1-hepta-1,3,5-trien-4-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 59893694 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 1-hepta-1,3,5-trien-4-ylpyrrolidin-2-one |
| SMILES | C=CC=C(C=CC)N1CCCC1=O |
| InChI | InChI=1S/C11H15NO/c1-3-6-10(7-4-2)12-9-5-8-11(12)13/h3-4,6-7H,1,5,8-9H2,2H3 |
| InChIKey | HMJUYKUNXORMGK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|