C11H15FN2O — CID 142246769
1-[(3E,5E)-5-amino-4-fluorohepta-1,3,5-trien-2-yl]pyrrolidin-2-one (PubChem CID 142246769) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is 1-[(3E,5E)-5-amino-4-fluorohepta-1,3,5-trien-2-yl]pyrrolidin-2-one.
| Compound Name | 1-[(3E,5E)-5-amino-4-fluorohepta-1,3,5-trien-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 142246769 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 1-[(3E,5E)-5-amino-4-fluorohepta-1,3,5-trien-2-yl]pyrrolidin-2-one |
| SMILES | C=C(/C=C(F)\C(N)=C/C)N1CCCC1=O |
| InChI | InChI=1S/C11H15FN2O/c1-3-10(13)9(12)7-8(2)14-6-4-5-11(14)15/h3,7H,2,4-6,13H2,1H3/b9-7+,10-3+ |
| InChIKey | UTXGRNDQASXBKU-KLHDTSITSA-N |
| XLogP | 1.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|