About 1-phenylpyrrolidin-2-one;tungsten
1-phenylpyrrolidin-2-one;tungsten (PubChem CID 58841050) has the molecular formula C10H10NOW-
and a molecular weight of 344.04 g/mol. Its IUPAC name is 1-phenylpyrrolidin-2-one;tungsten.
Molecular Properties
| Compound Name | 1-phenylpyrrolidin-2-one;tungsten |
| PubChem CID | 58841050 |
| Molecular Formula | C10H10NOW- |
| Molecular Weight | 344.04 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 1-phenylpyrrolidin-2-one;tungsten |
| SMILES | O=C1CCCN1c1cc[c-]cc1.[W] |
| InChI | InChI=1S/C10H10NO.W/c12-10-7-4-8-11(10)9-5-2-1-3-6-9;/h2-3,5-6H,4,7-8H2;/q-1; |
| InChIKey | BZWJKGWJCBTULP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.04 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpyrrolidin-2-one;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpyrrolidin-2-one;tungsten?
The IUPAC name of 1-phenylpyrrolidin-2-one;tungsten (CID 58841050) is 1-phenylpyrrolidin-2-one;tungsten.
What is the SMILES notation for 1-phenylpyrrolidin-2-one;tungsten?
The canonical SMILES for 1-phenylpyrrolidin-2-one;tungsten is O=C1CCCN1c1cc[c-]cc1.[W].
What is the InChIKey of 1-phenylpyrrolidin-2-one;tungsten?
The InChIKey is BZWJKGWJCBTULP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10NO.W/c12-10-7-4-8-11(10)9-5-2-1-3-6-9;/h2-3,5-6H,4,7-8H2;/q-1;.
What are the key properties of 1-phenylpyrrolidin-2-one;tungsten?
1-phenylpyrrolidin-2-one;tungsten has a molecular weight of 344.04 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpyrrolidin-2-one;tungsten is sourced from PubChem (CID 58841050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).