C9H16N2O — CID 123718960
1-[4-methyl-3-(methylamino)-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 123718960) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-[4-methyl-3-(methylamino)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 1-[4-methyl-3-(methylamino)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 123718960 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-[4-methyl-3-(methylamino)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | CNC1CN(C(C)=O)CC=C1C |
| InChI | InChI=1S/C9H16N2O/c1-7-4-5-11(8(2)12)6-9(7)10-3/h4,9-10H,5-6H2,1-3H3 |
| InChIKey | SPUXOPHGQXOAKE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|