C15H27NO — CID 135075295
N-[(2R)-6,10-dimethylundeca-5,9-dien-2-yl]acetamide (PubChem CID 135075295) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is N-[(2R)-6,10-dimethylundeca-5,9-dien-2-yl]acetamide.
| Compound Name | N-[(2R)-6,10-dimethylundeca-5,9-dien-2-yl]acetamide |
|---|---|
| PubChem CID | 135075295 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | N-[(2R)-6,10-dimethylundeca-5,9-dien-2-yl]acetamide |
| SMILES | CC(=O)N[C@H](C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C15H27NO/c1-12(2)8-6-9-13(3)10-7-11-14(4)16-15(5)17/h8,10,14H,6-7,9,11H2,1-5H3,(H,16,17)/t14-/m1/s1 |
| InChIKey | ZOICBOPIKMJCDL-CQSZACIVSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|