C9H15FN2O — CID 59110317
4-ethyl-3-(methylamino)-3,6-dihydro-2H-pyridine-1-carbonyl fluoride (PubChem CID 59110317) has the molecular formula C9H15FN2O and a molecular weight of 186.23 g/mol. Its IUPAC name is 4-ethyl-3-(methylamino)-3,6-dihydro-2H-pyridine-1-carbonyl fluoride.
| Compound Name | 4-ethyl-3-(methylamino)-3,6-dihydro-2H-pyridine-1-carbonyl fluoride |
|---|---|
| PubChem CID | 59110317 |
| Molecular Formula | C9H15FN2O |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4-ethyl-3-(methylamino)-3,6-dihydro-2H-pyridine-1-carbonyl fluoride |
| SMILES | CCC1=CCN(C(=O)F)CC1NC |
| InChI | InChI=1S/C9H15FN2O/c1-3-7-4-5-12(9(10)13)6-8(7)11-2/h4,8,11H,3,5-6H2,1-2H3 |
| InChIKey | DWGCFWRVDMQANY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|