C10H20N2O — CID 142314326
N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)formamide;ethane (PubChem CID 142314326) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)formamide;ethane.
| Compound Name | N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)formamide;ethane |
|---|---|
| PubChem CID | 142314326 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)formamide;ethane |
| SMILES | CC.CC1=CC(NC=O)CN(C)C1 |
| InChI | InChI=1S/C8H14N2O.C2H6/c1-7-3-8(9-6-11)5-10(2)4-7;1-2/h3,6,8H,4-5H2,1-2H3,(H,9,11);1-2H3 |
| InChIKey | WVQCYIZSMRSMKB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|