C11H22N2O — CID 142314392
N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-methylformamide;ethane (PubChem CID 142314392) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-methylformamide;ethane.
| Compound Name | N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-methylformamide;ethane |
|---|---|
| PubChem CID | 142314392 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | N-(1,5-dimethyl-3,6-dihydro-2H-pyridin-3-yl)-N-methylformamide;ethane |
| SMILES | CC.CC1=CC(N(C)C=O)CN(C)C1 |
| InChI | InChI=1S/C9H16N2O.C2H6/c1-8-4-9(11(3)7-12)6-10(2)5-8;1-2/h4,7,9H,5-6H2,1-3H3;1-2H3 |
| InChIKey | CFDDJRVYBMEXNJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|