C10H15F3N2O — CID 143562719
N-[6-methyl-1-(2,2,2-trifluoroethyl)-2,3,4,7-tetrahydroazepin-3-yl]formamide (PubChem CID 143562719) has the molecular formula C10H15F3N2O and a molecular weight of 236.24 g/mol. Its IUPAC name is N-[6-methyl-1-(2,2,2-trifluoroethyl)-2,3,4,7-tetrahydroazepin-3-yl]formamide.
| Compound Name | N-[6-methyl-1-(2,2,2-trifluoroethyl)-2,3,4,7-tetrahydroazepin-3-yl]formamide |
|---|---|
| PubChem CID | 143562719 |
| Molecular Formula | C10H15F3N2O |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | N-[6-methyl-1-(2,2,2-trifluoroethyl)-2,3,4,7-tetrahydroazepin-3-yl]formamide |
| SMILES | CC1=CCC(NC=O)CN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C10H15F3N2O/c1-8-2-3-9(14-7-16)5-15(4-8)6-10(11,12)13/h2,7,9H,3-6H2,1H3,(H,14,16) |
| InChIKey | RYYYLJKXSFLEMC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|