C11H18N2O — CID 57234254
N-(1,5-diethyl-2-methyl-2H-pyridin-3-yl)formamide (PubChem CID 57234254) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N-(1,5-diethyl-2-methyl-2H-pyridin-3-yl)formamide.
| Compound Name | N-(1,5-diethyl-2-methyl-2H-pyridin-3-yl)formamide |
|---|---|
| PubChem CID | 57234254 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-(1,5-diethyl-2-methyl-2H-pyridin-3-yl)formamide |
| SMILES | CCC1=CN(CC)C(C)C(NC=O)=C1 |
| InChI | InChI=1S/C11H18N2O/c1-4-10-6-11(12-8-14)9(3)13(5-2)7-10/h6-9H,4-5H2,1-3H3,(H,12,14) |
| InChIKey | XGZFKWCCBXGNLN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|