C12H16N2O — CID 89215095
N-[4-(2,5-dihydropyrrol-1-yl)-6-methylcyclohexa-1,5-dien-1-yl]formamide (PubChem CID 89215095) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N-[4-(2,5-dihydropyrrol-1-yl)-6-methylcyclohexa-1,5-dien-1-yl]formamide.
| Compound Name | N-[4-(2,5-dihydropyrrol-1-yl)-6-methylcyclohexa-1,5-dien-1-yl]formamide |
|---|---|
| PubChem CID | 89215095 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-[4-(2,5-dihydropyrrol-1-yl)-6-methylcyclohexa-1,5-dien-1-yl]formamide |
| SMILES | CC1=CC(N2CC=CC2)CC=C1NC=O |
| InChI | InChI=1S/C12H16N2O/c1-10-8-11(14-6-2-3-7-14)4-5-12(10)13-9-15/h2-3,5,8-9,11H,4,6-7H2,1H3,(H,13,15) |
| InChIKey | YCAADRAHJMAEAG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|