C12H20FN3O — CID 144684463
N-[(1Z,3E,5Z)-3-[[(2R)-2-aminopropyl]amino]-1-fluoro-5-methylhepta-1,3,5-trien-2-yl]formamide (PubChem CID 144684463) has the molecular formula C12H20FN3O and a molecular weight of 241.31 g/mol. Its IUPAC name is N-[(1Z,3E,5Z)-3-[[(2R)-2-aminopropyl]amino]-1-fluoro-5-methylhepta-1,3,5-trien-2-yl]formamide.
| Compound Name | N-[(1Z,3E,5Z)-3-[[(2R)-2-aminopropyl]amino]-1-fluoro-5-methylhepta-1,3,5-trien-2-yl]formamide |
|---|---|
| PubChem CID | 144684463 |
| Molecular Formula | C12H20FN3O |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-[(1Z,3E,5Z)-3-[[(2R)-2-aminopropyl]amino]-1-fluoro-5-methylhepta-1,3,5-trien-2-yl]formamide |
| SMILES | C/C=C(C)\C=C(NC[C@@H](C)N)/C(=C/F)NC=O |
| InChI | InChI=1S/C12H20FN3O/c1-4-9(2)5-11(15-7-10(3)14)12(6-13)16-8-17/h4-6,8,10,15H,7,14H2,1-3H3,(H,16,17)/b9-4-,11-5+,12-6-/t10-/m1/s1 |
| InChIKey | GCHNSMCUKFCKAV-JOUKLCBDSA-N |
| XLogP | 1.33 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|