C13H27N3O — CID 142345276
ethane;N-ethylformamide;N,1,5-trimethyl-2H-pyridin-3-amine (PubChem CID 142345276) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is ethane;N-ethylformamide;N,1,5-trimethyl-2H-pyridin-3-amine.
| Compound Name | ethane;N-ethylformamide;N,1,5-trimethyl-2H-pyridin-3-amine |
|---|---|
| PubChem CID | 142345276 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | ethane;N-ethylformamide;N,1,5-trimethyl-2H-pyridin-3-amine |
| SMILES | CC.CCNC=O.CNC1=CC(C)=CN(C)C1 |
| InChI | InChI=1S/C8H14N2.C3H7NO.C2H6/c1-7-4-8(9-2)6-10(3)5-7;1-2-4-3-5;1-2/h4-5,9H,6H2,1-3H3;3H,2H2,1H3,(H,4,5);1-2H3 |
| InChIKey | QXDJXGWZCMATEB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|