C12H25N3O — CID 142345197
N,5-dimethyl-1,2-dihydropyridin-3-amine;ethane;N-ethylformamide (PubChem CID 142345197) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is N,5-dimethyl-1,2-dihydropyridin-3-amine;ethane;N-ethylformamide.
| Compound Name | N,5-dimethyl-1,2-dihydropyridin-3-amine;ethane;N-ethylformamide |
|---|---|
| PubChem CID | 142345197 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | N,5-dimethyl-1,2-dihydropyridin-3-amine;ethane;N-ethylformamide |
| SMILES | CC.CCNC=O.CNC1=CC(C)=CNC1 |
| InChI | InChI=1S/C7H12N2.C3H7NO.C2H6/c1-6-3-7(8-2)5-9-4-6;1-2-4-3-5;1-2/h3-4,8-9H,5H2,1-2H3;3H,2H2,1H3,(H,4,5);1-2H3 |
| InChIKey | CVLJDFKUSVKKON-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|