C10H14N2O — CID 137427658
N-[3-methyl-7-(methylamino)cyclohepta-1,3,6-trien-1-yl]formamide (PubChem CID 137427658) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is N-[3-methyl-7-(methylamino)cyclohepta-1,3,6-trien-1-yl]formamide.
| Compound Name | N-[3-methyl-7-(methylamino)cyclohepta-1,3,6-trien-1-yl]formamide |
|---|---|
| PubChem CID | 137427658 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | N-[3-methyl-7-(methylamino)cyclohepta-1,3,6-trien-1-yl]formamide |
| SMILES | CNC1=CCC=C(C)C=C1NC=O |
| InChI | InChI=1S/C10H14N2O/c1-8-4-3-5-9(11-2)10(6-8)12-7-13/h4-7,11H,3H2,1-2H3,(H,12,13) |
| InChIKey | RKNRUQOTSBPTCC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|