C26H45F3N4O — CID 142211332
ethene;N-[(2Z,4Z)-2-[2-(ethylamino)ethyl-methylamino]hexa-2,4-dien-3-yl]formamide;(3Z,6E)-N-ethyl-8,8,8-trifluoro-N,7-dimethylocta-1,3,6-trien-2-amine (PubChem CID 142211332) has the molecular formula C26H45F3N4O and a molecular weight of 486.67 g/mol. Its IUPAC name is ethene;N-[(2Z,4Z)-2-[2-(ethylamino)ethyl-methylamino]hexa-2,4-dien-3-yl]formamide;(3Z,6E)-N-ethyl-8,8,8-trifluoro-N,7-dimethylocta-1,3,6-trien-2-amine.
| Compound Name | ethene;N-[(2Z,4Z)-2-[2-(ethylamino)ethyl-methylamino]hexa-2,4-dien-3-yl]formamide;(3Z,6E)-N-ethyl-8,8,8-trifluoro-N,7-dimethylocta-1,3,6-trien-2-amine |
|---|---|
| PubChem CID | 142211332 |
| Molecular Formula | C26H45F3N4O |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | ethene;N-[(2Z,4Z)-2-[2-(ethylamino)ethyl-methylamino]hexa-2,4-dien-3-yl]formamide;(3Z,6E)-N-ethyl-8,8,8-trifluoro-N,7-dimethylocta-1,3,6-trien-2-amine |
| SMILES | C/C=C\C(NC=O)=C(/C)N(C)CCNCC.C=C.C=C(/C=C\C/C=C(\C)C(F)(F)F)N(C)CC |
| InChI | InChI=1S/C12H18F3N.C12H23N3O.C2H4/c1-5-16(4)11(3)9-7-6-8-10(2)12(13,14)15;1-5-7-12(14-10-16)11(3)15(4)9-8-13-6-2;1-2/h7-9H,3,5-6H2,1-2,4H3;5,7,10,13H,6,8-9H2,1-4H3,(H,14,16);1-2H2/b9-7-,10-8+;7-5-,12-11-; |
| InChIKey | OPBKPXPKDRFJLO-OHQWEEPUSA-N |
| XLogP | 5.79 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|