C16H22F3N3O — CID 145312586
N-[(3E,5E)-6-aminohepta-1,3,5-trien-3-yl]formamide;(1E,3Z)-N-methyl-5-(trifluoromethyl)hexa-1,3,5-trien-1-amine (PubChem CID 145312586) has the molecular formula C16H22F3N3O and a molecular weight of 329.37 g/mol. Its IUPAC name is N-[(3E,5E)-6-aminohepta-1,3,5-trien-3-yl]formamide;(1E,3Z)-N-methyl-5-(trifluoromethyl)hexa-1,3,5-trien-1-amine.
| Compound Name | N-[(3E,5E)-6-aminohepta-1,3,5-trien-3-yl]formamide;(1E,3Z)-N-methyl-5-(trifluoromethyl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 145312586 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[(3E,5E)-6-aminohepta-1,3,5-trien-3-yl]formamide;(1E,3Z)-N-methyl-5-(trifluoromethyl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C(/C=C\C=C\NC)C(F)(F)F.C=C/C(=C\C=C(/C)N)NC=O |
| InChI | InChI=1S/C8H10F3N.C8H12N2O/c1-7(8(9,10)11)5-3-4-6-12-2;1-3-8(10-6-11)5-4-7(2)9/h3-6,12H,1H2,2H3;3-6H,1,9H2,2H3,(H,10,11)/b5-3-,6-4+;7-4+,8-5+ |
| InChIKey | QKNQYIYPZBSVGD-WSZLHIRBSA-N |
| XLogP | 3.06 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|