C9H14N2 — CID 144645278
(2Z,4Z)-6-methylideneocta-2,4,7-triene-2,5-diamine (PubChem CID 144645278) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (2Z,4Z)-6-methylideneocta-2,4,7-triene-2,5-diamine.
| Compound Name | (2Z,4Z)-6-methylideneocta-2,4,7-triene-2,5-diamine |
|---|---|
| PubChem CID | 144645278 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (2Z,4Z)-6-methylideneocta-2,4,7-triene-2,5-diamine |
| SMILES | C=CC(=C)/C(N)=C\C=C(\C)N |
| InChI | InChI=1S/C9H14N2/c1-4-7(2)9(11)6-5-8(3)10/h4-6H,1-2,10-11H2,3H3/b8-5-,9-6- |
| InChIKey | NMGIHEKHDAQMOE-VVRUXRSYSA-N |
| XLogP | 1.43 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|