C21H20N8 — CID 123719354
N-[1-[7-(aminomethyl)-1-phenylbenzimidazol-2-yl]ethyl]-7H-purin-6-amine (PubChem CID 123719354) has the molecular formula C21H20N8 and a molecular weight of 384.45 g/mol. Its IUPAC name is N-[1-[7-(aminomethyl)-1-phenylbenzimidazol-2-yl]ethyl]-7H-purin-6-amine.
| Compound Name | N-[1-[7-(aminomethyl)-1-phenylbenzimidazol-2-yl]ethyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 123719354 |
| Molecular Formula | C21H20N8 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-[1-[7-(aminomethyl)-1-phenylbenzimidazol-2-yl]ethyl]-7H-purin-6-amine |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1nc2cccc(CN)c2n1-c1ccccc1 |
| InChI | InChI=1S/C21H20N8/c1-13(27-20-17-19(24-11-23-17)25-12-26-20)21-28-16-9-5-6-14(10-22)18(16)29(21)15-7-3-2-4-8-15/h2-9,11-13H,10,22H2,1H3,(H2,23,24,25,26,27) |
| InChIKey | SUBBGONITHAICA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |