C32H52Si — CID 123719672
bis(2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilane (PubChem CID 123719672) has the molecular formula C32H52Si and a molecular weight of 464.85 g/mol. Its IUPAC name is bis(2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilane.
| Compound Name | bis(2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 123719672 |
| Molecular Formula | C32H52Si |
| Molecular Weight | 464.85 g/mol |
| Exact Mass | 464.38 |
| IUPAC Name | bis(2,3,4,5,6,7-hexamethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilane |
| SMILES | CC1=C(C)C2C(C)C(C)C([Si](C)(C)C3C(C)C(C)C4C(C)=C(C)C(C)=C(C)C43)C2C(C)=C1C |
| InChI | InChI=1S/C32H52Si/c1-15-17(3)21(7)29-27(19(15)5)23(9)25(11)31(29)33(13,14)32-26(12)24(10)28-20(6)16(2)18(4)22(8)30(28)32/h23-32H,1-14H3 |
| InChIKey | JZMJIQIYGBYINX-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.85 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|