C36H36FN3O — CID 123719925
4-[4-[2-[7-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]-3-methyl-3H-1-benzazepin-5-yl]propyl]phenyl]morpholine (PubChem CID 123719925) has the molecular formula C36H36FN3O and a molecular weight of 545.70 g/mol. Its IUPAC name is 4-[4-[2-[7-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]-3-methyl-3H-1-benzazepin-5-yl]propyl]phenyl]morpholine.
| Compound Name | 4-[4-[2-[7-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]-3-methyl-3H-1-benzazepin-5-yl]propyl]phenyl]morpholine |
|---|---|
| PubChem CID | 123719925 |
| Molecular Formula | C36H36FN3O |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 4-[4-[2-[7-[2-(4-fluoro-3-methylphenyl)-3-pyridinyl]-3-methyl-3H-1-benzazepin-5-yl]propyl]phenyl]morpholine |
| SMILES | Cc1cc(-c2ncccc2-c2ccc3c(c2)C(C(C)Cc2ccc(N4CCOCC4)cc2)=CC(C)C=N3)ccc1F |
| InChI | InChI=1S/C36H36FN3O/c1-24-19-32(25(2)20-27-6-10-30(11-7-27)40-15-17-41-18-16-40)33-22-28(9-13-35(33)39-23-24)31-5-4-14-38-36(31)29-8-12-34(37)26(3)21-29/h4-14,19,21-25H,15-18,20H2,1-3H3 |
| InChIKey | OGLCESJEDUNEME-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|