C10H20O8S2 — CID 123723146
(4S,5S)-1-[ethyl(dihydroxy)-λ4-sulfanyl]-1-ethylperoxysulfanyl-4,5-dihydroxyhexane-2,3-dione (PubChem CID 123723146) has the molecular formula C10H20O8S2 and a molecular weight of 332.40 g/mol. Its IUPAC name is (4S,5S)-1-[ethyl(dihydroxy)-λ4-sulfanyl]-1-ethylperoxysulfanyl-4,5-dihydroxyhexane-2,3-dione.
| Compound Name | (4S,5S)-1-[ethyl(dihydroxy)-λ4-sulfanyl]-1-ethylperoxysulfanyl-4,5-dihydroxyhexane-2,3-dione |
|---|---|
| PubChem CID | 123723146 |
| Molecular Formula | C10H20O8S2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (4S,5S)-1-[ethyl(dihydroxy)-λ4-sulfanyl]-1-ethylperoxysulfanyl-4,5-dihydroxyhexane-2,3-dione |
| SMILES | CCOOSC(C(=O)C(=O)[C@@H](O)[C@H](C)O)S(O)(O)CC |
| InChI | InChI=1S/C10H20O8S2/c1-4-17-18-19-10(20(15,16)5-2)9(14)8(13)7(12)6(3)11/h6-7,10-12,15-16H,4-5H2,1-3H3/t6-,7-,10?/m0/s1 |
| InChIKey | DNEDDMWRANYVGQ-CKZABAASSA-N |
| XLogP | 0.58 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|