C23H28ClNO4 — CID 123723241
2-[7-chloro-6-[[4-(dimethylamino)phenyl]methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 123723241) has the molecular formula C23H28ClNO4 and a molecular weight of 417.93 g/mol. Its IUPAC name is 2-[7-chloro-6-[[4-(dimethylamino)phenyl]methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[7-chloro-6-[[4-(dimethylamino)phenyl]methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 123723241 |
| Molecular Formula | C23H28ClNO4 |
| Molecular Weight | 417.93 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 2-[7-chloro-6-[[4-(dimethylamino)phenyl]methyl]-2,3-dihydro-1-benzofuran-4-yl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | CN(C)c1ccc(Cc2cc(C3CC(O)CC(CO)O3)c3c(c2Cl)OCC3)cc1 |
| InChI | InChI=1S/C23H28ClNO4/c1-25(2)16-5-3-14(4-6-16)9-15-10-20(19-7-8-28-23(19)22(15)24)21-12-17(27)11-18(13-26)29-21/h3-6,10,17-18,21,26-27H,7-9,11-13H2,1-2H3 |
| InChIKey | XSSHSAYOMNUXCA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.93 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|