C67H46N6S — CID 123724746
2-[3-[3-[9-[3-[3-(4,6-diphenyl-1,4-dihydro-1,3,5-triazin-2-yl)phenyl]phenyl]thioxanthen-9-yl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 123724746) has the molecular formula C67H46N6S and a molecular weight of 967.21 g/mol. Its IUPAC name is 2-[3-[3-[9-[3-[3-(4,6-diphenyl-1,4-dihydro-1,3,5-triazin-2-yl)phenyl]phenyl]thioxanthen-9-yl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[3-[9-[3-[3-(4,6-diphenyl-1,4-dihydro-1,3,5-triazin-2-yl)phenyl]phenyl]thioxanthen-9-yl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 123724746 |
| Molecular Formula | C67H46N6S |
| Molecular Weight | 967.21 g/mol |
| Exact Mass | 966.35 |
| IUPAC Name | 2-[3-[3-[9-[3-[3-(4,6-diphenyl-1,4-dihydro-1,3,5-triazin-2-yl)phenyl]phenyl]thioxanthen-9-yl]phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(C2=NC(c3ccccc3)N=C(c3cccc(-c4cccc(C5(c6cccc(-c7cccc(-c8nc(-c9ccccc9)nc(-c9ccccc9)n8)c7)c6)c6ccccc6Sc6ccccc65)c4)c3)N2)cc1 |
| InChI | InChI=1S/C67H46N6S/c1-5-21-45(22-6-1)61-68-62(46-23-7-2-8-24-46)71-65(70-61)53-33-17-29-49(41-53)51-31-19-35-55(43-51)67(57-37-13-15-39-59(57)74-60-40-16-14-38-58(60)67)56-36-20-32-52(44-56)50-30-18-34-54(42-50)66-72-63(47-25-9-3-10-26-47)69-64(73-66)48-27-11-4-12-28-48/h1-44,61H,(H,68,70,71) |
| InChIKey | VLADDVGVNAVKPC-UHFFFAOYSA-N |
| XLogP | 15.55 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.21 |
| LogP ≤ 5 | 15.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |