C24H23FN2O3 — CID 123724997
butyl 6-(4-fluorobenzoyl)-2,5-dihydro-1H-azepino[4,5-b]indole-5-carboxylate (PubChem CID 123724997) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is butyl 6-(4-fluorobenzoyl)-2,5-dihydro-1H-azepino[4,5-b]indole-5-carboxylate.
| Compound Name | butyl 6-(4-fluorobenzoyl)-2,5-dihydro-1H-azepino[4,5-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 123724997 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | butyl 6-(4-fluorobenzoyl)-2,5-dihydro-1H-azepino[4,5-b]indole-5-carboxylate |
| SMILES | CCCCOC(=O)C1C=NCCc2c1n(C(=O)c1ccc(F)cc1)c1ccccc21 |
| InChI | InChI=1S/C24H23FN2O3/c1-2-3-14-30-24(29)20-15-26-13-12-19-18-6-4-5-7-21(18)27(22(19)20)23(28)16-8-10-17(25)11-9-16/h4-11,15,20H,2-3,12-14H2,1H3 |
| InChIKey | VNNNOUKZRMLGEN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|